CAS 1194374-32-7 appears in our catalog under these names: 3'-(Methylsulfonyl)biphenyl-3-carboxylic acid, 98%, 3'-(Methylsulfonyl)-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(3-methylsulfonylphenyl)benzoic acid (CAS 1194374-32-7) is a chemical compound with the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. IUPAC name: 3-(3-methylsulfonylphenyl)benzoic acid. InChIKey: CRFKLEDBWMGUED-UHFFFAOYSA-N.
| Molecular formula | C14H12O4S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 3-(3-methylsulfonylphenyl)benzoic acid |
| InChIKey | CRFKLEDBWMGUED-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)