Products 893736-90-8

CAS 893736-90-8 is the registry number for 4'-(Methylsulfonyl)-(1,1'-biphenyl)-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-(4-methylsulfonylphenyl)benzoic acid (CAS 893736-90-8) is a chemical compound with the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. IUPAC name: 2-(4-methylsulfonylphenyl)benzoic acid. InChIKey: OEXWRSFMFJAAHT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O4S
Molecular weight276.31 g/mol
IUPAC name2-(4-methylsulfonylphenyl)benzoic acid
InChIKeyOEXWRSFMFJAAHT-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC=C(C=C1)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)