CAS 893736-70-4 is the registry number for 4'-(Methylsulfonyl)biphenyl-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-methylsulfonylphenyl)benzoic acid (CAS 893736-70-4) is a chemical compound with the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. IUPAC name: 3-(4-methylsulfonylphenyl)benzoic acid. InChIKey: DCCBLTKXTWVRDZ-UHFFFAOYSA-N.
| Molecular formula | C14H12O4S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 3-(4-methylsulfonylphenyl)benzoic acid |
| InChIKey | DCCBLTKXTWVRDZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)