CAS 80459-48-9 appears in our catalog under these names: 4-Formylphenyl 4-methylbenzenesulfonate, 95%, 4-Formylphenyl 4-Methylbenzenesulfonate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g.
(4-formylphenyl) 4-methylbenzenesulfonate (CAS 80459-48-9) is a chemical compound with the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. IUPAC name: (4-formylphenyl) 4-methylbenzenesulfonate. InChIKey: UPOKXWYTSBUETD-UHFFFAOYSA-N.
| Molecular formula | C14H12O4S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | (4-formylphenyl) 4-methylbenzenesulfonate |
| InChIKey | UPOKXWYTSBUETD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)