CAS 19820-56-5 appears in our catalog under these names: 2-Formylphenyl 4-methylbenzenesulfonate, 95%, 2-Formylphenyl 4-methylbenzenesulfonate 95%, 2-Formylphenyl 4-methylbenzenesulfonate, 97%, 97%, 2-formylphenyl 4-methylbenzenesulfonate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2-formylphenyl) 4-methylbenzenesulfonate (CAS 19820-56-5) is a chemical compound with the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. IUPAC name: (2-formylphenyl) 4-methylbenzenesulfonate. InChIKey: IPWGJYLXLDJKOC-UHFFFAOYSA-N.
| Molecular formula | C14H12O4S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | (2-formylphenyl) 4-methylbenzenesulfonate |
| InChIKey | IPWGJYLXLDJKOC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC=C2C=O |
Computed by PubChem (NCBI)