Products 119448-27-0
CAS 119448-27-0 appears in our catalog under these names: Imidazo[1,2-a]pyridine-2-carbohydrazide, 95%, Imidazo(1,2-a)pyridine-2-carbohydrazide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
Imidazo[1,2-a]pyridine-2-carbohydrazide (CAS 119448-27-0) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: imidazo[1,2-a]pyridine-2-carbohydrazide. InChIKey: RHZQESDITRQWDU-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | imidazo[1,2-a]pyridine-2-carbohydrazide |
| InChIKey | RHZQESDITRQWDU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C(=O)NN |
Computed by PubChem (NCBI)