CAS 1194483-04-9 is the registry number for 2-Oxo-2,3-dihydro-1H-benzo(d)imidazol-5-ylboronic Acid. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
(2-oxo-1,3-dihydrobenzimidazol-5-yl)boronic acid (CAS 1194483-04-9) is a chemical compound with the molecular formula C7H7BN2O3 and a molecular weight of 177.96 g/mol. IUPAC name: (2-oxo-1,3-dihydrobenzimidazol-5-yl)boronic acid. InChIKey: OYSAVIADHNAOQT-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O3 |
|---|---|
| Molecular weight | 177.96 g/mol |
| IUPAC name | (2-oxo-1,3-dihydrobenzimidazol-5-yl)boronic acid |
| InChIKey | OYSAVIADHNAOQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=O)N2)(O)O |
Computed by PubChem (NCBI)