CAS 1598437-67-2 is the registry number for (7-Oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-3-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(7-oxo-5,6-dihydropyrrolo[3,4-b]pyridin-3-yl)boronic acid (CAS 1598437-67-2) is a chemical compound with the molecular formula C7H7BN2O3 and a molecular weight of 177.96 g/mol. IUPAC name: (7-oxo-5,6-dihydropyrrolo[3,4-b]pyridin-3-yl)boronic acid. InChIKey: DIYAVMXLDMJTOX-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O3 |
|---|---|
| Molecular weight | 177.96 g/mol |
| IUPAC name | (7-oxo-5,6-dihydropyrrolo[3,4-b]pyridin-3-yl)boronic acid |
| InChIKey | DIYAVMXLDMJTOX-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C(=O)NC2)N=C1)(O)O |
Computed by PubChem (NCBI)