CAS 2225172-47-2 is the registry number for 1–(2–Furyl)–1H–pyrazole–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[1-(furan-2-yl)pyrazol-4-yl]boronic acid (CAS 2225172-47-2) is a chemical compound with the molecular formula C7H7BN2O3 and a molecular weight of 177.96 g/mol. IUPAC name: [1-(furan-2-yl)pyrazol-4-yl]boronic acid. InChIKey: YVEGLQPZPARUJN-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O3 |
|---|---|
| Molecular weight | 177.96 g/mol |
| IUPAC name | [1-(furan-2-yl)pyrazol-4-yl]boronic acid |
| InChIKey | YVEGLQPZPARUJN-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC=CO2)(O)O |
Computed by PubChem (NCBI)