CAS 2225170-51-2 appears in our catalog under these names: 2–Methoxy–6–cyanopyridine–4–boronic acid, (2-Cyano-6-methoxypyridin-4-yl)boronic acid, 98%, 98%, (2-Cyano-6-methoxypyridin-4-yl)boronic acid, 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 25mg, 5mg, 250mg, 1g.
(2-cyano-6-methoxy-4-pyridinyl)boronic acid (CAS 2225170-51-2) is a chemical compound with the molecular formula C7H7BN2O3 and a molecular weight of 177.96 g/mol. IUPAC name: (2-cyano-6-methoxy-4-pyridinyl)boronic acid. InChIKey: UPIIJSQQYUJJQD-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O3 |
|---|---|
| Molecular weight | 177.96 g/mol |
| IUPAC name | (2-cyano-6-methoxy-4-pyridinyl)boronic acid |
| InChIKey | UPIIJSQQYUJJQD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)OC)C#N)(O)O |
Computed by PubChem (NCBI)