CAS 2056916-13-1 is the registry number for (2-Aminobenzo[d]oxazol-4-yl)boronic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-amino-1,3-benzoxazol-4-yl)boronic acid (CAS 2056916-13-1) is a chemical compound with the molecular formula C7H7BN2O3 and a molecular weight of 177.96 g/mol. IUPAC name: (2-amino-1,3-benzoxazol-4-yl)boronic acid. InChIKey: SRTYDTCHLMRZPP-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O3 |
|---|---|
| Molecular weight | 177.96 g/mol |
| IUPAC name | (2-amino-1,3-benzoxazol-4-yl)boronic acid |
| InChIKey | SRTYDTCHLMRZPP-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OC(=N2)N)(O)O |
Computed by PubChem (NCBI)