Products 1195233-59-0
CAS 1195233-59-0 is the registry number for Ethyllucidone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
(2E)-2-[(E)-1-ethoxy-3-phenylprop-2-enylidene]-4-methoxycyclopent-4-ene-1,3-dione (CAS 1195233-59-0) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (2E)-2-[(E)-1-ethoxy-3-phenylprop-2-enylidene]-4-methoxycyclopent-4-ene-1,3-dione. InChIKey: BEDCQNBTLHLBEP-WAJBHNFBSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (2E)-2-[(E)-1-ethoxy-3-phenylprop-2-enylidene]-4-methoxycyclopent-4-ene-1,3-dione |
| InChIKey | BEDCQNBTLHLBEP-WAJBHNFBSA-N |
| SMILES | CCO/C(=C/1\C(=O)C=C(C1=O)OC)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)