CAS 1196151-13-9 is the registry number for 6-Amino-2,3,4-trifluorobenzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-amino-2,3,4-trifluorobenzoic acid (CAS 1196151-13-9) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 6-amino-2,3,4-trifluorobenzoic acid. InChIKey: NPOKVVQMFRQBAO-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 6-amino-2,3,4-trifluorobenzoic acid |
| InChIKey | NPOKVVQMFRQBAO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)C(=O)O)N |
Computed by PubChem (NCBI)