Products 1196151-98-0
CAS 1196151-98-0 is the registry number for 2,4-Dichloro-7,8-dihydroquinazolin-5(6H)-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,4-dichloro-7,8-dihydro-6H-quinazolin-5-one (CAS 1196151-98-0) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 2,4-dichloro-7,8-dihydro-6H-quinazolin-5-one. InChIKey: ZKMCPJPQTBHGSX-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,4-dichloro-7,8-dihydro-6H-quinazolin-5-one |
| InChIKey | ZKMCPJPQTBHGSX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)