Products 1196157-27-3
CAS 1196157-27-3 appears in our catalog under these names: 2,4-Dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine, 97%, 2,4-Dichloro-6-methyl-5h-pyrrolo[3,2-d]pyrimidine, 98%, 2，4-Dichloro-6-methyl-5h-pyrrolo[3，2-d]pyrimidine, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
2,4-dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine (CAS 1196157-27-3) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 2,4-dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine. InChIKey: WXFDPWLIEMUJRE-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 2,4-dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| InChIKey | WXFDPWLIEMUJRE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)