Products 1196501-56-0
CAS 1196501-56-0 is the registry number for Ethyl 4-amino-3-chlorobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Ethyl 4-amino-3-chlorobenzoate;hydrochloride (CAS 1196501-56-0) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: ethyl 4-amino-3-chlorobenzoate;hydrochloride. InChIKey: SIMDBDSZCIGUKE-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | ethyl 4-amino-3-chlorobenzoate;hydrochloride |
| InChIKey | SIMDBDSZCIGUKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)Cl.Cl |
Computed by PubChem (NCBI)