Products 120108-62-5
CAS 120108-62-5 appears in our catalog under these names: 2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride, 95%, 2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride, 2-Amino-3-(3-chlorophenyl)propionic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 2,5g, 10g.
2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride (CAS 120108-62-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride. InChIKey: MLKORXUFSMVSBB-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | MLKORXUFSMVSBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-amino-3-(3-chlorophenyl)propanoic Acid Hydrochloride, 2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride, 2-amino-3-(3-chlorophenyl)propionic acid hydrochloride, H-Phe(3-Cl)-OH.HCl, 3-Chloro-L-phenylalanine hydrochloride, 3-Chlorophenylalanine--hydrogen chloride (1/1), 2-amino-3-(3-chlorophenyl)propanoic acid, chloride