Products 2227272-88-8
CAS 2227272-88-8 appears in our catalog under these names: Methyl 2-[6-(chloromethyl)-2-pyridyl]acetate hydrochloride, 95%, Methyl 2-(6-(chloromethyl)pyridin-2-yl)acetate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 2-[6-(chloromethyl)-2-pyridinyl]acetate;hydrochloride (CAS 2227272-88-8) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl 2-[6-(chloromethyl)-2-pyridinyl]acetate;hydrochloride. InChIKey: NNFUNWFONUOWMI-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | methyl 2-[6-(chloromethyl)-2-pyridinyl]acetate;hydrochloride |
| InChIKey | NNFUNWFONUOWMI-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=NC(=CC=C1)CCl.Cl |
Computed by PubChem (NCBI)