Products 490034-82-7
CAS 490034-82-7 appears in our catalog under these names: (3S)-3-amino-3-(2-chlorophenyl)propanoic acid hydrochloride, 95%, (3S)-3-Amino-3-(2-chlorophenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
(3S)-3-amino-3-(2-chlorophenyl)propanoic acid;hydrochloride (CAS 490034-82-7) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (3S)-3-amino-3-(2-chlorophenyl)propanoic acid;hydrochloride. InChIKey: STLSXIDFGSTKTE-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (3S)-3-amino-3-(2-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | STLSXIDFGSTKTE-QRPNPIFTSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CC(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)