CAS 930769-55-4 appears in our catalog under these names: (S)-3-Amino-3-(4-chlorophenyl)propanoic acid hydrochloride, 95%, (S)–3–Amino–3–(4–chlorophenyl)propanoic acid hydrochloride, (S)-3-Amino-3-(4-chlorophenyl)propanoic acid hydrochloride, 98%, 98%, (S)-3-AMINO-3-(4-CHLOROPHENYL)PROPANOIC ACID HCL, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(3S)-3-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride (CAS 930769-55-4) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (3S)-3-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride. InChIKey: OWLYBHXRFBLXNQ-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | OWLYBHXRFBLXNQ-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)