CAS 119756-20-6 appears in our catalog under these names: 1,2-Dihydro-1-oxo-pyrrolo(1,2-a)pyrazine-3-carboxylic acid methyl ester, 95%, Methyl 1-oxo-1H,2H-pyrrolo(1,2-a)pyrazine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 1-oxo-2H-pyrrolo[1,2-a]pyrazine-3-carboxylate (CAS 119756-20-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 1-oxo-2H-pyrrolo[1,2-a]pyrazine-3-carboxylate. InChIKey: BMARQCJFLBTLGL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 1-oxo-2H-pyrrolo[1,2-a]pyrazine-3-carboxylate |
| InChIKey | BMARQCJFLBTLGL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C=CC=C2C(=O)N1 |
Computed by PubChem (NCBI)