CAS 916210-93-0 appears in our catalog under these names: (S)-5-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, (S)-5-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride 95%, (S)-5-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%, (S)-5-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g.
(1S)-5-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 916210-93-0) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: (1S)-5-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: GLGQSSHHFWJLAI-FVGYRXGTSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | (1S)-5-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | GLGQSSHHFWJLAI-FVGYRXGTSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC(=C2)Br.Cl |
Computed by PubChem (NCBI)