CAS 1198208-10-4 is the registry number for 4-Chloro biphenyl-2-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-chloro-2-phenylbenzaldehyde (CAS 1198208-10-4) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 5-chloro-2-phenylbenzaldehyde. InChIKey: BPWATAJMPLXNIV-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 5-chloro-2-phenylbenzaldehyde |
| InChIKey | BPWATAJMPLXNIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)