CAS 1199215-91-2 is the registry number for Methyl 4-(4h-1,2,4-triazol-3-yl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 4-(1H-1,2,4-triazol-5-yl)benzoate (CAS 1199215-91-2) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: methyl 4-(1H-1,2,4-triazol-5-yl)benzoate. InChIKey: HBBMQBJFBRVVTI-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | methyl 4-(1H-1,2,4-triazol-5-yl)benzoate |
| InChIKey | HBBMQBJFBRVVTI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC=NN2 |
Computed by PubChem (NCBI)