Products 1199589-61-1
CAS 1199589-61-1 is the registry number for 2-Amino-4-(4-phenoxyphenyl)-1H-pyrrole-3-carbonitrile, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-amino-4-(4-phenoxyphenyl)-1H-pyrrole-3-carbonitrile (CAS 1199589-61-1) is a chemical compound with the molecular formula C17H13N3O and a molecular weight of 275.30 g/mol. IUPAC name: 2-amino-4-(4-phenoxyphenyl)-1H-pyrrole-3-carbonitrile. InChIKey: BMCRLJVEFBZFJC-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 2-amino-4-(4-phenoxyphenyl)-1H-pyrrole-3-carbonitrile |
| InChIKey | BMCRLJVEFBZFJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=CNC(=C3C#N)N |
Computed by PubChem (NCBI)