Products 190436-27-2
CAS 190436-27-2 is the registry number for 4-(hydroxyimino)-3-(4-methylphenyl)indeno(2,3-d)pyrazole. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-methylphenyl)-4-nitroso-1,2-dihydroindeno[1,2-c]pyrazole (CAS 190436-27-2) is a chemical compound with the molecular formula C17H13N3O and a molecular weight of 275.30 g/mol. IUPAC name: 3-(4-methylphenyl)-4-nitroso-1,2-dihydroindeno[1,2-c]pyrazole. InChIKey: RCYWDMDMNAPRRU-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 3-(4-methylphenyl)-4-nitroso-1,2-dihydroindeno[1,2-c]pyrazole |
| InChIKey | RCYWDMDMNAPRRU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C3C(=C4C=CC=CC4=C3N=O)NN2 |
Computed by PubChem (NCBI)