CAS 219959-87-2 is the registry number for 9-(4’-Hydroxyaminophenyl)-9H-pyrido(3,4-b)indole. Offered by: TRC. Available pack sizes: 10mg, 25mg.
N-(4-pyrido[3,4-b]indol-9-ylphenyl)hydroxylamine (CAS 219959-87-2) is a chemical compound with the molecular formula C17H13N3O and a molecular weight of 275.30 g/mol. IUPAC name: N-(4-pyrido[3,4-b]indol-9-ylphenyl)hydroxylamine. InChIKey: LECLBYWFRKFHIQ-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | N-(4-pyrido[3,4-b]indol-9-ylphenyl)hydroxylamine |
| InChIKey | LECLBYWFRKFHIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2C4=CC=C(C=C4)NO)C=NC=C3 |
Computed by PubChem (NCBI)