CAS 852933-96-1 is the registry number for 2-(3-(Diphenylmethyl)-1,2,4-oxadiazol-5-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(3-benzhydryl-1,2,4-oxadiazol-5-yl)acetonitrile (CAS 852933-96-1) is a chemical compound with the molecular formula C17H13N3O and a molecular weight of 275.30 g/mol. IUPAC name: 2-(3-benzhydryl-1,2,4-oxadiazol-5-yl)acetonitrile. InChIKey: CBJIYVLYWQOWAF-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 2-(3-benzhydryl-1,2,4-oxadiazol-5-yl)acetonitrile |
| InChIKey | CBJIYVLYWQOWAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=NOC(=N3)CC#N |
Computed by PubChem (NCBI)