CAS 1243657-78-4 is the registry number for (E)-3-((1-Methyl-1h-indol-3-yl)methylene)-1h-pyrrolo[3,2-b]pyridin-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3E)-3-[(1-methylindol-3-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one (CAS 1243657-78-4) is a chemical compound with the molecular formula C17H13N3O and a molecular weight of 275.30 g/mol. IUPAC name: (3E)-3-[(1-methylindol-3-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one. InChIKey: NXNQLECPAXXYTR-UKTHLTGXSA-N.
| Molecular formula | C17H13N3O |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (3E)-3-[(1-methylindol-3-yl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one |
| InChIKey | NXNQLECPAXXYTR-UKTHLTGXSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)/C=C/3\C4=C(C=CC=N4)NC3=O |
Computed by PubChem (NCBI)