CAS 1199774-68-9 is the registry number for 2-Bromo-n,n-dimethyl-5-(trifluoromethyl)benzenemethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
1-[2-bromo-5-(trifluoromethyl)phenyl]-N,N-dimethylmethanamine (CAS 1199774-68-9) is a chemical compound with the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. IUPAC name: 1-[2-bromo-5-(trifluoromethyl)phenyl]-N,N-dimethylmethanamine. InChIKey: JSEUXQGFCPBRIF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3N |
|---|---|
| Molecular weight | 282.10 g/mol |
| IUPAC name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-N,N-dimethylmethanamine |
| InChIKey | JSEUXQGFCPBRIF-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)