CAS 1895675-91-8 is the registry number for (4-Bromo-2-trifluoromethyl-benzyl)-dimethyl-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[4-bromo-2-(trifluoromethyl)phenyl]-N,N-dimethylmethanamine (CAS 1895675-91-8) is a chemical compound with the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. IUPAC name: 1-[4-bromo-2-(trifluoromethyl)phenyl]-N,N-dimethylmethanamine. InChIKey: MKFTYKFWMCTZOO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3N |
|---|---|
| Molecular weight | 282.10 g/mol |
| IUPAC name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-N,N-dimethylmethanamine |
| InChIKey | MKFTYKFWMCTZOO-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)