CAS 1704075-90-0 appears in our catalog under these names: 2–(4–bromo–3–(trifluoromethyl)phenyl)propan–2–amine hydrochloride, 2-[4-bromo-3-(trifluoromethyl)phenyl]propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 50mg.
2-[4-bromo-3-(trifluoromethyl)phenyl]propan-2-amine (CAS 1704075-90-0) is a chemical compound with the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. IUPAC name: 2-[4-bromo-3-(trifluoromethyl)phenyl]propan-2-amine. InChIKey: ZXWFZQBQWQWLIK-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3N |
|---|---|
| Molecular weight | 282.10 g/mol |
| IUPAC name | 2-[4-bromo-3-(trifluoromethyl)phenyl]propan-2-amine |
| InChIKey | ZXWFZQBQWQWLIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)Br)C(F)(F)F)N |
Computed by PubChem (NCBI)