CAS 1250792-21-2 appears in our catalog under these names: 1-(3-Bromophenyl)-4,4,4-trifluorobutan-2-amine, 1-(3-Bromophenyl)-4,4,4-trifluorobutan-2-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(3-bromophenyl)-4,4,4-trifluorobutan-2-amine (CAS 1250792-21-2) is a chemical compound with the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. IUPAC name: 1-(3-bromophenyl)-4,4,4-trifluorobutan-2-amine. InChIKey: VSNZFBHFCUYGCB-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3N |
|---|---|
| Molecular weight | 282.10 g/mol |
| IUPAC name | 1-(3-bromophenyl)-4,4,4-trifluorobutan-2-amine |
| InChIKey | VSNZFBHFCUYGCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CC(CC(F)(F)F)N |
Computed by PubChem (NCBI)