CAS 1530908-56-5 is the registry number for [(2-Bromo-5-methylphenyl)methyl](2,2,2-trifluoroethyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(2-bromo-5-methylphenyl)methyl]-2,2,2-trifluoroethanamine (CAS 1530908-56-5) is a chemical compound with the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. IUPAC name: N-[(2-bromo-5-methylphenyl)methyl]-2,2,2-trifluoroethanamine. InChIKey: PQLDMDLMJBLLQI-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3N |
|---|---|
| Molecular weight | 282.10 g/mol |
| IUPAC name | N-[(2-bromo-5-methylphenyl)methyl]-2,2,2-trifluoroethanamine |
| InChIKey | PQLDMDLMJBLLQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Br)CNCC(F)(F)F |
Computed by PubChem (NCBI)