CAS 1199775-03-5 is the registry number for 3-((tert-Butoxycarbonyl)(methyl)amino)-2,2-dimethylpropanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2,2-dimethyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 1199775-03-5) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 2,2-dimethyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: PDVPUMMDQRXURL-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2,2-dimethyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | PDVPUMMDQRXURL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC(C)(C)C(=O)O |
Computed by PubChem (NCBI)