Products 1200-55-1
CAS 1200-55-1 is the registry number for Pralidoxime Methyl Sulphate. Offered by: Chemat Brand, Mikromol, LoGiCal. Available pack sizes: on request, 100mg, 10mg.
(NE)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine;methyl sulfate (CAS 1200-55-1) is a chemical compound with the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. IUPAC name: (NE)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine;methyl sulfate. InChIKey: OVPHBYQAKDEEBD-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O5S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | (NE)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine;methyl sulfate |
| InChIKey | OVPHBYQAKDEEBD-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=CC=C1/C=N/O.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Contrastigmin, Pralidoxime methyl sulfate, Contrastigmine, Pyridinium, 2-formyl-1-methyl-, methyl sulfate, oxime, Pyridinium, 2-((hydroxyimino)methyl)-1-methyl-, methyl sulfate (salt), N-methylpyridinium 2-aldoxime methylsulfate, Pralidoxime Methyl Sulphate, Pyridine-2-aldoxime methylsulfate, 2-Formyl-1-methylpyridinium methyl sulfate oxime, Sulfomethylate de pralidoxime [French]