CAS 1565117-62-5 is the registry number for Ethyl 5-(1-(methylsulfonyl)ethyl)-1,2,4-oxadiazole-3-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 5-(1-methylsulfonylethyl)-1,2,4-oxadiazole-3-carboxylate (CAS 1565117-62-5) is a chemical compound with the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. IUPAC name: ethyl 5-(1-methylsulfonylethyl)-1,2,4-oxadiazole-3-carboxylate. InChIKey: VYNMVJMPTJBSJF-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O5S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | ethyl 5-(1-methylsulfonylethyl)-1,2,4-oxadiazole-3-carboxylate |
| InChIKey | VYNMVJMPTJBSJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=N1)C(C)S(=O)(=O)C |
Computed by PubChem (NCBI)