Products 2102408-78-4

CAS 2102408-78-4 is the registry number for 3,4-Dihydro-2h-1,4-benzoxazin-6-amine sulfate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3,4-dihydro-2H-1,4-benzoxazin-6-amine;sulfuric acid (CAS 2102408-78-4) is a chemical compound with the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. IUPAC name: 3,4-dihydro-2H-1,4-benzoxazin-6-amine;sulfuric acid. InChIKey: MZDQKKDESBIXOL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O5S
Molecular weight248.26 g/mol
IUPAC name3,4-dihydro-2H-1,4-benzoxazin-6-amine;sulfuric acid
InChIKeyMZDQKKDESBIXOL-UHFFFAOYSA-N
SMILESC1COC2=C(N1)C=C(C=C2)N.OS(=O)(=O)O

Computed by PubChem (NCBI)