CAS 1989671-75-1 is the registry number for tert-Butyl 5-sulfamoyl-1,2-oxazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 5-sulfamoyl-1,2-oxazole-3-carboxylate (CAS 1989671-75-1) is a chemical compound with the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. IUPAC name: tert-butyl 5-sulfamoyl-1,2-oxazole-3-carboxylate. InChIKey: PXETXALUFSWVPS-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O5S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | tert-butyl 5-sulfamoyl-1,2-oxazole-3-carboxylate |
| InChIKey | PXETXALUFSWVPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NOC(=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)