Products 937627-87-7

CAS 937627-87-7 is the registry number for 4-((2-Methoxyethyl)sulfamoyl)-1H-pyrrole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carboxylic acid (CAS 937627-87-7) is a chemical compound with the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. IUPAC name: 4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carboxylic acid. InChIKey: DTWHJKXEPGNCNS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O5S
Molecular weight248.26 g/mol
IUPAC name4-(2-methoxyethylsulfamoyl)-1H-pyrrole-2-carboxylic acid
InChIKeyDTWHJKXEPGNCNS-UHFFFAOYSA-N
SMILESCOCCNS(=O)(=O)C1=CNC(=C1)C(=O)O

Computed by PubChem (NCBI)