Products 120019-68-3
CAS 120019-68-3 is the registry number for (R)-[1,1'-Binaphthalen]-2-amine, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
1-naphthalen-1-ylnaphthalen-2-amine (CAS 120019-68-3) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 1-naphthalen-1-ylnaphthalen-2-amine. InChIKey: ZAPYLSLVQJQGEY-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 1-naphthalen-1-ylnaphthalen-2-amine |
| InChIKey | ZAPYLSLVQJQGEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=C(C=CC4=CC=CC=C43)N |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Binaphthalen]-2-amine, 1-naphthalen-1-ylnaphthalen-2-amine, (R)-[1,1'-Binaphthalen]-2-amine, (S)-[1,1'-Binaphthalen]-2-amine, (1S)-[1,1'-Binaphthalen]-2-amine, binaphthylamine, 1-(1-naphthyl)naphthalen-2-amine, 1,1'-Binaphthalen]-2-amine, [1,1 '-binaphthalene] -2-amine, 2-Amino-1-(1-naphthyl)naphthalene