CAS 1215003-81-8 is the registry number for 10-(o-Tolyl)benzo(h)quinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g.
10-(2-methylphenyl)benzo[h]quinoline (CAS 1215003-81-8) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 10-(2-methylphenyl)benzo[h]quinoline. InChIKey: XWEWEQMRQVKKCO-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 10-(2-methylphenyl)benzo[h]quinoline |
| InChIKey | XWEWEQMRQVKKCO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=CC3=C2C4=C(C=CC=N4)C=C3 |
Computed by PubChem (NCBI)