CAS 6639-43-6 is the registry number for Triphenylacetonitrile, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
2,2,2-triphenylacetonitrile (CAS 6639-43-6) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 2,2,2-triphenylacetonitrile. InChIKey: IFLGNTXHZCYIJD-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2,2,2-triphenylacetonitrile |
| InChIKey | IFLGNTXHZCYIJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C#N)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)