CAS 98683-00-2 appears in our catalog under these names: N-Phenyl-1-anthramine, 95%, N-Phenyl-1-anthramine, >98.0%(GC). Offered by: Combi-blocks, TCI. Available pack sizes: 500mg.
N-phenylanthracen-1-amine (CAS 98683-00-2) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: N-phenylanthracen-1-amine. InChIKey: QCOIZKZASBFCJG-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | N-phenylanthracen-1-amine |
| InChIKey | QCOIZKZASBFCJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC3=CC4=CC=CC=C4C=C32 |
Computed by PubChem (NCBI)