CAS 737-89-3 appears in our catalog under these names: 1,1'-Dinaphthylamine, 95%, 1,1'–Dinaphthylamine, 1,1'-Dinaphthylamine, >98.0%(HPLC)(N), Di(naphthalen-1-yl)amine, DINAPHTHALEN-1-YLAMINE, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
N-naphthalen-1-ylnaphthalen-1-amine (CAS 737-89-3) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: N-naphthalen-1-ylnaphthalen-1-amine. InChIKey: VMVGVGMRBKYIGN-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | N-naphthalen-1-ylnaphthalen-1-amine |
| InChIKey | VMVGVGMRBKYIGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)