Products 1200447-00-2
CAS 1200447-00-2 appears in our catalog under these names: L-Lysine-13C6,15N2 Hydrochloride, >95% (HPLC), L–Lysine–13C6，15N2 Hydrochloride, L–Lysine–13C6,15N2 hydrochloride, L-Lysine-13C6,15N2 hydrochloride, L-Lysine-13C6,15N2 (hydrochloride). Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1mg, 5mg, 25mg, 250mg, 5 mg.
(2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;hydrochloride (CAS 1200447-00-2) is a chemical compound with the molecular formula C6H15ClN2O2 and a molecular weight of 190.59 g/mol. IUPAC name: (2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;hydrochloride. InChIKey: BVHLGVCQOALMSV-GSMNGUNQSA-N.
| Molecular formula | C6H15ClN2O2 |
|---|---|
| Molecular weight | 190.59 g/mol |
| IUPAC name | (2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;hydrochloride |
| InChIKey | BVHLGVCQOALMSV-GSMNGUNQSA-N |
| SMILES | [13CH2]([13CH2][13CH2][15NH2])[13CH2][13C@@H]([13C](=O)O)[15NH2].Cl |
Computed by PubChem (NCBI)