Products 2330878-43-6
CAS 2330878-43-6 appears in our catalog under these names: L-Lysine-2,6,6-d3 HCl, >95% (HPLC), L-Lysine-2,6,6-d3 HCl, 98 atom % D, min 98% Chemical Purity, L–Lysine–d3 (hydrochloride), L-Lysine-d3 (hydrochloride). Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 1mg, 25mg, 1 mg.
(2S)-2,6-diamino-2,6,6-trideuteriohexanoic acid;hydrochloride (CAS 2330878-43-6) is a chemical compound with the molecular formula C6H15ClN2O2 and a molecular weight of 185.67 g/mol. IUPAC name: (2S)-2,6-diamino-2,6,6-trideuteriohexanoic acid;hydrochloride. InChIKey: BVHLGVCQOALMSV-FUVXPQFCSA-N.
| Molecular formula | C6H15ClN2O2 |
|---|---|
| Molecular weight | 185.67 g/mol |
| IUPAC name | (2S)-2,6-diamino-2,6,6-trideuteriohexanoic acid;hydrochloride |
| InChIKey | BVHLGVCQOALMSV-FUVXPQFCSA-N |
| SMILES | [2H][C@](CCCC([2H])([2H])N)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)