Products 344298-93-7
CAS 344298-93-7 appears in our catalog under these names: L-Lysine-3,3,4,4,5,5,6,6-d8 Hydrochloride, >95% (HPLC), L-Lysine-3,3,4,4,5,5,6,6-d8 HCl, 99 atom % D, min 98% Chemical Purity, L–Lysine–d8 hydrochloride, L-Lysine-d8 (hydrochloride), 99.88%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 0,1g, 0,05g, 1mg, 5mg, 1 mg, 10 mg.
(2S)-2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;hydrochloride (CAS 344298-93-7) is a chemical compound with the molecular formula C6H15ClN2O2 and a molecular weight of 190.70 g/mol. IUPAC name: (2S)-2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;hydrochloride. InChIKey: BVHLGVCQOALMSV-RLIARQKESA-N.
| Molecular formula | C6H15ClN2O2 |
|---|---|
| Molecular weight | 190.70 g/mol |
| IUPAC name | (2S)-2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;hydrochloride |
| InChIKey | BVHLGVCQOALMSV-RLIARQKESA-N |
| SMILES | [2H]C([2H])([C@@H](C(=O)O)N)C([2H])([2H])C([2H])([2H])C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)