CAS 284664-96-6 appears in our catalog under these names: L-Lysine-4,4,5,5-d4 Hydrochloride, >95% (HPLC), L-Lysine-4,4,5,5-d4 HCl, 98 atom % D, min 98% Chemical Purity, L-Lysine-d4 (hydrochloride), 99.78%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 0,1g, 0,05g, 5 mg, 1 mg, 10 mg.
(2S)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;hydrochloride (CAS 284664-96-6) is a chemical compound with the molecular formula C6H15ClN2O2 and a molecular weight of 186.67 g/mol. IUPAC name: (2S)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;hydrochloride. InChIKey: BVHLGVCQOALMSV-UGJIAQRQSA-N.
| Molecular formula | C6H15ClN2O2 |
|---|---|
| Molecular weight | 186.67 g/mol |
| IUPAC name | (2S)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;hydrochloride |
| InChIKey | BVHLGVCQOALMSV-UGJIAQRQSA-N |
| SMILES | [2H]C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])CN.Cl |
Computed by PubChem (NCBI)