Products 2714413-18-8
CAS 2714413-18-8 appears in our catalog under these names: D-Lysine-4,4,5,5-d4 HCl, 98 atom % D, min 98% Chemical Purity, D-Lysine-d4 (monohydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5 mg, 10 mg, 1 mg.
(2R)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;hydrochloride (CAS 2714413-18-8) is a chemical compound with the molecular formula C6H15ClN2O2 and a molecular weight of 186.67 g/mol. IUPAC name: (2R)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;hydrochloride. InChIKey: BVHLGVCQOALMSV-HMKNRSCMSA-N.
| Molecular formula | C6H15ClN2O2 |
|---|---|
| Molecular weight | 186.67 g/mol |
| IUPAC name | (2R)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;hydrochloride |
| InChIKey | BVHLGVCQOALMSV-HMKNRSCMSA-N |
| SMILES | [2H]C([2H])(C[C@H](C(=O)O)N)C([2H])([2H])CN.Cl |
Computed by PubChem (NCBI)